C16H18N4O — CID 7118736
5-benzyl-1-tert-butylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 7118736) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 5-benzyl-1-tert-butylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-benzyl-1-tert-butylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7118736 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5-benzyl-1-tert-butylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC(C)(C)n1ncc2c(=O)n(Cc3ccccc3)cnc21 |
| InChI | InChI=1S/C16H18N4O/c1-16(2,3)20-14-13(9-18-20)15(21)19(11-17-14)10-12-7-5-4-6-8-12/h4-9,11H,10H2,1-3H3 |
| InChIKey | NFBXBEKSEMBEHT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |