C30H27F5N4O3S — CID 71187508
N-[(1S)-2-(3,5-difluorophenyl)-1-[3-(4-methylsulfonylphenyl)-2-pyridinyl]ethyl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide (PubChem CID 71187508) has the molecular formula C30H27F5N4O3S and a molecular weight of 618.63 g/mol. Its IUPAC name is N-[(1S)-2-(3,5-difluorophenyl)-1-[3-(4-methylsulfonylphenyl)-2-pyridinyl]ethyl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide.
| Compound Name | N-[(1S)-2-(3,5-difluorophenyl)-1-[3-(4-methylsulfonylphenyl)-2-pyridinyl]ethyl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide |
|---|---|
| PubChem CID | 71187508 |
| Molecular Formula | C30H27F5N4O3S |
| Molecular Weight | 618.63 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | N-[(1S)-2-(3,5-difluorophenyl)-1-[3-(4-methylsulfonylphenyl)-2-pyridinyl]ethyl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide |
| SMILES | CS(=O)(=O)c1ccc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)NC(=O)Cn2nc(C(F)(F)F)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C30H27F5N4O3S/c1-43(41,42)22-10-8-19(9-11-22)23-6-4-12-36-28(23)25(15-18-13-20(31)16-21(32)14-18)37-27(40)17-39-26-7-3-2-5-24(26)29(38-39)30(33,34)35/h4,6,8-14,16,25H,2-3,5,7,15,17H2,1H3,(H,37,40)/t25-/m0/s1 |
| InChIKey | CGFZNVJQRMNNLC-VWLOTQADSA-N |
| XLogP | 5.62 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |