C14H14N4O — CID 71188369
N-(4-methoxyphenyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 71188369) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(4-methoxyphenyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71188369 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-(4-methoxyphenyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | COc1ccc(Nc2ncnc3ccn(C)c23)cc1 |
| InChI | InChI=1S/C14H14N4O/c1-18-8-7-12-13(18)14(16-9-15-12)17-10-3-5-11(19-2)6-4-10/h3-9H,1-2H3,(H,15,16,17) |
| InChIKey | XOBGOMUJNZDMAJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |