C23H24N2O3 — CID 71188810
[4-[(3,4-dihydroxyphenyl)methyl]piperazin-1-yl]-(4-methylnaphthalen-1-yl)methanone (PubChem CID 71188810) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is [4-[(3,4-dihydroxyphenyl)methyl]piperazin-1-yl]-(4-methylnaphthalen-1-yl)methanone.
| Compound Name | [4-[(3,4-dihydroxyphenyl)methyl]piperazin-1-yl]-(4-methylnaphthalen-1-yl)methanone |
|---|---|
| PubChem CID | 71188810 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [4-[(3,4-dihydroxyphenyl)methyl]piperazin-1-yl]-(4-methylnaphthalen-1-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(Cc3ccc(O)c(O)c3)CC2)c2ccccc12 |
| InChI | InChI=1S/C23H24N2O3/c1-16-6-8-20(19-5-3-2-4-18(16)19)23(28)25-12-10-24(11-13-25)15-17-7-9-21(26)22(27)14-17/h2-9,14,26-27H,10-13,15H2,1H3 |
| InChIKey | UBSMDPGOUKFFPM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|