C21H25BClN2O3 — CID 71194269
CID 71194269 (PubChem CID 71194269) has the molecular formula C21H25BClN2O3 and a molecular weight of 399.71 g/mol.
| Compound Name | CID 71194269 |
|---|---|
| PubChem CID | 71194269 |
| Molecular Formula | C21H25BClN2O3 |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc(CC(NC(=O)c2ccc(OC(C)C)c(Cl)c2)C(=O)NC)cc1 |
| InChI | InChI=1S/C21H25BClN2O3/c1-13(2)28-19-10-7-15(12-17(19)23)20(26)25-18(21(27)24-4)11-14-5-8-16(22-3)9-6-14/h5-10,12-13,18H,11H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | ZTLJROCDCNRHDP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|