C20H24BrClN2O3 — CID 147871098
(2S)-3-(4-bromophenyl)-2-[[(3-chloro-4-propan-2-yloxyphenyl)-hydroxymethyl]amino]-N-methylpropanamide (PubChem CID 147871098) has the molecular formula C20H24BrClN2O3 and a molecular weight of 455.78 g/mol. Its IUPAC name is (2S)-3-(4-bromophenyl)-2-[[(3-chloro-4-propan-2-yloxyphenyl)-hydroxymethyl]amino]-N-methylpropanamide.
| Compound Name | (2S)-3-(4-bromophenyl)-2-[[(3-chloro-4-propan-2-yloxyphenyl)-hydroxymethyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 147871098 |
| Molecular Formula | C20H24BrClN2O3 |
| Molecular Weight | 455.78 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | (2S)-3-(4-bromophenyl)-2-[[(3-chloro-4-propan-2-yloxyphenyl)-hydroxymethyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](Cc1ccc(Br)cc1)NC(O)c1ccc(OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C20H24BrClN2O3/c1-12(2)27-18-9-6-14(11-16(18)22)19(25)24-17(20(26)23-3)10-13-4-7-15(21)8-5-13/h4-9,11-12,17,19,24-25H,10H2,1-3H3,(H,23,26)/t17-,19?/m0/s1 |
| InChIKey | HYPYYPKDHRZGKA-KKFHFHRHSA-N |
| XLogP | 3.83 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.78 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|