C29H34O11 — CID 71195142
[(1S,2S,4S,7R,9S,10S,12R)-1,9,12-trihydroxy-4-methoxycarbonyloxy-10,14,17,17-tetramethyl-11,15-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 71195142) has the molecular formula C29H34O11 and a molecular weight of 558.58 g/mol. Its IUPAC name is [(1S,2S,4S,7R,9S,10S,12R)-1,9,12-trihydroxy-4-methoxycarbonyloxy-10,14,17,17-tetramethyl-11,15-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(1S,2S,4S,7R,9S,10S,12R)-1,9,12-trihydroxy-4-methoxycarbonyloxy-10,14,17,17-tetramethyl-11,15-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 71195142 |
| Molecular Formula | C29H34O11 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | [(1S,2S,4S,7R,9S,10S,12R)-1,9,12-trihydroxy-4-methoxycarbonyloxy-10,14,17,17-tetramethyl-11,15-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | COC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)C(=O)C[C@@](O)(C(OC(=O)c4ccccc4)C12)C3(C)C |
| InChI | InChI=1S/C29H34O11/c1-14-16(30)12-29(36)23(39-24(34)15-9-7-6-8-10-15)21-27(4,22(33)20(32)19(14)26(29,2)3)17(31)11-18-28(21,13-38-18)40-25(35)37-5/h6-10,17-18,20-21,23,31-32,36H,11-13H2,1-5H3/t17-,18+,20+,21?,23?,27+,28-,29+/m0/s1 |
| InChIKey | LLIKRISRJXBTAJ-OOALRSRVSA-N |
| XLogP | 1.51 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |