C13H14N4O5 — CID 71195870
4-[[4-(carboxyamino)-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylic acid (PubChem CID 71195870) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is 4-[[4-(carboxyamino)-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-[[4-(carboxyamino)-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 71195870 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[[4-(carboxyamino)-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylic acid |
| SMILES | Cn1cc(NC(=O)c2cc(NC(=O)O)cn2C)cc1C(=O)O |
| InChI | InChI=1S/C13H14N4O5/c1-16-6-8(15-13(21)22)3-9(16)11(18)14-7-4-10(12(19)20)17(2)5-7/h3-6,15H,1-2H3,(H,14,18)(H,19,20)(H,21,22) |
| InChIKey | VUZISHMMGOKEHS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |