C13H17N4O2P — CID 23394637
N-(5-acetyl-1-methylpyrrol-3-yl)-1-methyl-4-(phosphanylamino)pyrrole-2-carboxamide (PubChem CID 23394637) has the molecular formula C13H17N4O2P and a molecular weight of 292.28 g/mol. Its IUPAC name is N-(5-acetyl-1-methylpyrrol-3-yl)-1-methyl-4-(phosphanylamino)pyrrole-2-carboxamide.
| Compound Name | N-(5-acetyl-1-methylpyrrol-3-yl)-1-methyl-4-(phosphanylamino)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 23394637 |
| Molecular Formula | C13H17N4O2P |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-(5-acetyl-1-methylpyrrol-3-yl)-1-methyl-4-(phosphanylamino)pyrrole-2-carboxamide |
| SMILES | CC(=O)c1cc(NC(=O)c2cc(NP)cn2C)cn1C |
| InChI | InChI=1S/C13H17N4O2P/c1-8(18)11-4-9(6-16(11)2)14-13(19)12-5-10(15-20)7-17(12)3/h4-7,15H,20H2,1-3H3,(H,14,19) |
| InChIKey | JFLXOTUVXBSYGU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|