C8H12N2O2 — CID 142228577
1-[4-(methoxyamino)-1-methylpyrrol-2-yl]ethanone (PubChem CID 142228577) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-[4-(methoxyamino)-1-methylpyrrol-2-yl]ethanone.
| Compound Name | 1-[4-(methoxyamino)-1-methylpyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 142228577 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-[4-(methoxyamino)-1-methylpyrrol-2-yl]ethanone |
| SMILES | CONc1cc(C(C)=O)n(C)c1 |
| InChI | InChI=1S/C8H12N2O2/c1-6(11)8-4-7(9-12-3)5-10(8)2/h4-5,9H,1-3H3 |
| InChIKey | NETIHFNGDHQRRX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|