C7H6BClN2O2 — CID 20820655
CID 20820655 (PubChem CID 20820655) has the molecular formula C7H6BClN2O2 and a molecular weight of 196.40 g/mol.
| Compound Name | CID 20820655 |
|---|---|
| PubChem CID | 20820655 |
| Molecular Formula | C7H6BClN2O2 |
| Molecular Weight | 196.40 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | — |
| SMILES | [B]C(=O)Nc1cc(C(=O)Cl)n(C)c1 |
| InChI | InChI=1S/C7H6BClN2O2/c1-11-3-4(10-7(8)13)2-5(11)6(9)12/h2-3H,1H3,(H,10,13) |
| InChIKey | SJQDPBTTZOHHLT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|