C9H8Cl2N2O2 — CID 140996449
4-[(3-chloro-3-oxoprop-1-en-2-yl)amino]-1-methylpyrrole-2-carbonyl chloride (PubChem CID 140996449) has the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.08 g/mol. Its IUPAC name is 4-[(3-chloro-3-oxoprop-1-en-2-yl)amino]-1-methylpyrrole-2-carbonyl chloride.
| Compound Name | 4-[(3-chloro-3-oxoprop-1-en-2-yl)amino]-1-methylpyrrole-2-carbonyl chloride |
|---|---|
| PubChem CID | 140996449 |
| Molecular Formula | C9H8Cl2N2O2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 4-[(3-chloro-3-oxoprop-1-en-2-yl)amino]-1-methylpyrrole-2-carbonyl chloride |
| SMILES | C=C(Nc1cc(C(=O)Cl)n(C)c1)C(=O)Cl |
| InChI | InChI=1S/C9H8Cl2N2O2/c1-5(8(10)14)12-6-3-7(9(11)15)13(2)4-6/h3-4,12H,1H2,2H3 |
| InChIKey | BHFNHBVUOMVFFX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|