C10H16N2OS2 — CID 166738655
1-[4-[1-(disulfanyl)propan-2-ylamino]-1-methylpyrrol-2-yl]ethanone (PubChem CID 166738655) has the molecular formula C10H16N2OS2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-[4-[1-(disulfanyl)propan-2-ylamino]-1-methylpyrrol-2-yl]ethanone.
| Compound Name | 1-[4-[1-(disulfanyl)propan-2-ylamino]-1-methylpyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 166738655 |
| Molecular Formula | C10H16N2OS2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-[4-[1-(disulfanyl)propan-2-ylamino]-1-methylpyrrol-2-yl]ethanone |
| SMILES | CC(=O)c1cc(NC(C)CSS)cn1C |
| InChI | InChI=1S/C10H16N2OS2/c1-7(6-15-14)11-9-4-10(8(2)13)12(3)5-9/h4-5,7,11,14H,6H2,1-3H3 |
| InChIKey | AZTNSRGMFYPLOM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|