C16H12Br2ClNO6 — CID 71198054
(2R)-3-[3,5-dibromo-4-[(2-chloro-3-nitrophenyl)methoxy]phenyl]-2-hydroxypropanoic acid (PubChem CID 71198054) has the molecular formula C16H12Br2ClNO6 and a molecular weight of 509.53 g/mol. Its IUPAC name is (2R)-3-[3,5-dibromo-4-[(2-chloro-3-nitrophenyl)methoxy]phenyl]-2-hydroxypropanoic acid.
| Compound Name | (2R)-3-[3,5-dibromo-4-[(2-chloro-3-nitrophenyl)methoxy]phenyl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 71198054 |
| Molecular Formula | C16H12Br2ClNO6 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 506.87 |
| IUPAC Name | (2R)-3-[3,5-dibromo-4-[(2-chloro-3-nitrophenyl)methoxy]phenyl]-2-hydroxypropanoic acid |
| SMILES | O=C(O)[C@H](O)Cc1cc(Br)c(OCc2cccc([N+](=O)[O-])c2Cl)c(Br)c1 |
| InChI | InChI=1S/C16H12Br2ClNO6/c17-10-4-8(6-13(21)16(22)23)5-11(18)15(10)26-7-9-2-1-3-12(14(9)19)20(24)25/h1-5,13,21H,6-7H2,(H,22,23)/t13-/m1/s1 |
| InChIKey | YKTQLCGOPGJBPI-CYBMUJFWSA-N |
| XLogP | 4.34 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|