C17H15Br2ClFNO3 — CID 87813527
methyl 3-[4-[(3-amino-2-chlorophenyl)methoxy]-3,5-dibromophenyl]-2-fluoropropanoate (PubChem CID 87813527) has the molecular formula C17H15Br2ClFNO3 and a molecular weight of 495.57 g/mol. Its IUPAC name is methyl 3-[4-[(3-amino-2-chlorophenyl)methoxy]-3,5-dibromophenyl]-2-fluoropropanoate.
| Compound Name | methyl 3-[4-[(3-amino-2-chlorophenyl)methoxy]-3,5-dibromophenyl]-2-fluoropropanoate |
|---|---|
| PubChem CID | 87813527 |
| Molecular Formula | C17H15Br2ClFNO3 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 492.91 |
| IUPAC Name | methyl 3-[4-[(3-amino-2-chlorophenyl)methoxy]-3,5-dibromophenyl]-2-fluoropropanoate |
| SMILES | COC(=O)C(F)Cc1cc(Br)c(OCc2cccc(N)c2Cl)c(Br)c1 |
| InChI | InChI=1S/C17H15Br2ClFNO3/c1-24-17(23)13(21)7-9-5-11(18)16(12(19)6-9)25-8-10-3-2-4-14(22)15(10)20/h2-6,13H,7-8,22H2,1H3 |
| InChIKey | BBLRTQKFCDTNRH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|