C18H19Br2FN2O3 — CID 87484894
methyl 3-[4-[4-amino-3-(ethylamino)phenoxy]-3,5-dibromophenyl]-2-fluoropropanoate (PubChem CID 87484894) has the molecular formula C18H19Br2FN2O3 and a molecular weight of 490.17 g/mol. Its IUPAC name is methyl 3-[4-[4-amino-3-(ethylamino)phenoxy]-3,5-dibromophenyl]-2-fluoropropanoate.
| Compound Name | methyl 3-[4-[4-amino-3-(ethylamino)phenoxy]-3,5-dibromophenyl]-2-fluoropropanoate |
|---|---|
| PubChem CID | 87484894 |
| Molecular Formula | C18H19Br2FN2O3 |
| Molecular Weight | 490.17 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | methyl 3-[4-[4-amino-3-(ethylamino)phenoxy]-3,5-dibromophenyl]-2-fluoropropanoate |
| SMILES | CCNc1cc(Oc2c(Br)cc(CC(F)C(=O)OC)cc2Br)ccc1N |
| InChI | InChI=1S/C18H19Br2FN2O3/c1-3-23-16-9-11(4-5-15(16)22)26-17-12(19)6-10(7-13(17)20)8-14(21)18(24)25-2/h4-7,9,14,23H,3,8,22H2,1-2H3 |
| InChIKey | XWTOKQXFUOMYHV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.17 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|