C13H11N5OS — CID 71198394
1-(5-cyano-2-diazenylphenyl)-3-(thiophen-2-ylmethyl)urea (PubChem CID 71198394) has the molecular formula C13H11N5OS and a molecular weight of 285.33 g/mol. Its IUPAC name is 1-(5-cyano-2-diazenylphenyl)-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-(5-cyano-2-diazenylphenyl)-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 71198394 |
| Molecular Formula | C13H11N5OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-(5-cyano-2-diazenylphenyl)-3-(thiophen-2-ylmethyl)urea |
| SMILES | [H]/N=N/c1ccc(C#N)cc1NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C13H11N5OS/c14-7-9-3-4-11(18-15)12(6-9)17-13(19)16-8-10-2-1-5-20-10/h1-6,15H,8H2,(H2,16,17,19)/b18-15+ |
| InChIKey | JPVOPCFNNJRHOM-OBGWFSINSA-N |
| XLogP | 3.60 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|