About 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium
1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium (PubChem CID 7120164) has the molecular formula C17H24FN3+2
and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium.
Molecular Properties
| Compound Name | 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium |
| PubChem CID | 7120164 |
| Molecular Formula | C17H24FN3+2 |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium |
| SMILES | Cn1cccc1C[NH+]1CC[NH+](Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H22FN3/c1-19-8-2-3-17(19)14-21-11-9-20(10-12-21)13-15-4-6-16(18)7-5-15/h2-8H,9-14H2,1H3/p+2 |
| InChIKey | SRJVREYBKYZWJF-UHFFFAOYSA-P |
| XLogP | -0.35 |
| TPSA | 13.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium?
The IUPAC name of 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium (CID 7120164) is 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium.
What is the SMILES notation for 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium?
The canonical SMILES for 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium is Cn1cccc1C[NH+]1CC[NH+](Cc2ccc(F)cc2)CC1.
What is the InChIKey of 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium?
The InChIKey is SRJVREYBKYZWJF-UHFFFAOYSA-P. The full InChI is InChI=1S/C17H22FN3/c1-19-8-2-3-17(19)14-21-11-9-20(10-12-21)13-15-4-6-16(18)7-5-15/h2-8H,9-14H2,1H3/p+2.
What are the key properties of 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium?
1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium has a molecular weight of 289.40 g/mol, XLogP of -0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-fluorophenyl)methyl]-4-[(1-methylpyrrol-2-yl)methyl]piperazine-1,4-diium is sourced from PubChem (CID 7120164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).