C22H32N2+2 — CID 6981095
1,4-bis[(4-ethylphenyl)methyl]piperazine-1,4-diium (PubChem CID 6981095) has the molecular formula C22H32N2+2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1,4-bis[(4-ethylphenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1,4-bis[(4-ethylphenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6981095 |
| Molecular Formula | C22H32N2+2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 1,4-bis[(4-ethylphenyl)methyl]piperazine-1,4-diium |
| SMILES | CCc1ccc(C[NH+]2CC[NH+](Cc3ccc(CC)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H30N2/c1-3-19-5-9-21(10-6-19)17-23-13-15-24(16-14-23)18-22-11-7-20(4-2)8-12-22/h5-12H,3-4,13-18H2,1-2H3/p+2 |
| InChIKey | QBGZWAOKVWUNSN-UHFFFAOYSA-P |
| XLogP | 1.29 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |