C17H30N2 — CID 71203351
3,3,5,5,6-pentamethyl-2-pyridin-2-ylheptan-1-amine (PubChem CID 71203351) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 3,3,5,5,6-pentamethyl-2-pyridin-2-ylheptan-1-amine.
| Compound Name | 3,3,5,5,6-pentamethyl-2-pyridin-2-ylheptan-1-amine |
|---|---|
| PubChem CID | 71203351 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 3,3,5,5,6-pentamethyl-2-pyridin-2-ylheptan-1-amine |
| SMILES | CC(C)C(C)(C)CC(C)(C)C(CN)c1ccccn1 |
| InChI | InChI=1S/C17H30N2/c1-13(2)16(3,4)12-17(5,6)14(11-18)15-9-7-8-10-19-15/h7-10,13-14H,11-12,18H2,1-6H3 |
| InChIKey | KSARIYUVYQXPOI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |