C12H14N2O5 — CID 71203985
methyl N-[(1S,2R)-2-(hydroxymethyl)-1-(3-nitrophenyl)cyclopropyl]carbamate (PubChem CID 71203985) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is methyl N-[(1S,2R)-2-(hydroxymethyl)-1-(3-nitrophenyl)cyclopropyl]carbamate.
| Compound Name | methyl N-[(1S,2R)-2-(hydroxymethyl)-1-(3-nitrophenyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 71203985 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | methyl N-[(1S,2R)-2-(hydroxymethyl)-1-(3-nitrophenyl)cyclopropyl]carbamate |
| SMILES | COC(=O)N[C@@]1(c2cccc([N+](=O)[O-])c2)C[C@H]1CO |
| InChI | InChI=1S/C12H14N2O5/c1-19-11(16)13-12(6-9(12)7-15)8-3-2-4-10(5-8)14(17)18/h2-5,9,15H,6-7H2,1H3,(H,13,16)/t9-,12+/m0/s1 |
| InChIKey | KXMHHLYKRLMFIG-JOYOIKCWSA-N |
| XLogP | 1.16 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|