C29H33N5O5S — CID 71206736
6-[acetamido(methyl)carbamoyl]-13-cyclohexyl-N-(methylsulfamoyl)-7H-indolo[2,1-a][2]benzazepine-10-carboxamide (PubChem CID 71206736) has the molecular formula C29H33N5O5S and a molecular weight of 563.68 g/mol. Its IUPAC name is 6-[acetamido(methyl)carbamoyl]-13-cyclohexyl-N-(methylsulfamoyl)-7H-indolo[2,1-a][2]benzazepine-10-carboxamide.
| Compound Name | 6-[acetamido(methyl)carbamoyl]-13-cyclohexyl-N-(methylsulfamoyl)-7H-indolo[2,1-a][2]benzazepine-10-carboxamide |
|---|---|
| PubChem CID | 71206736 |
| Molecular Formula | C29H33N5O5S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 6-[acetamido(methyl)carbamoyl]-13-cyclohexyl-N-(methylsulfamoyl)-7H-indolo[2,1-a][2]benzazepine-10-carboxamide |
| SMILES | CNS(=O)(=O)NC(=O)c1ccc2c(C3CCCCC3)c3n(c2c1)CC(C(=O)N(C)NC(C)=O)=Cc1ccccc1-3 |
| InChI | InChI=1S/C29H33N5O5S/c1-18(35)31-33(3)29(37)22-15-20-11-7-8-12-23(20)27-26(19-9-5-4-6-10-19)24-14-13-21(16-25(24)34(27)17-22)28(36)32-40(38,39)30-2/h7-8,11-16,19,30H,4-6,9-10,17H2,1-3H3,(H,31,35)(H,32,36) |
| InChIKey | GETUHSQNMGGZDB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|