C33H39N5O5S — CID 89371650
6-(4-acetylpiperazine-1-carbonyl)-13-cyclohexyl-N-dimethylsulfinamoyloxy-7H-indolo[2,1-a][2]benzazepine-10-carboxamide (PubChem CID 89371650) has the molecular formula C33H39N5O5S and a molecular weight of 617.77 g/mol. Its IUPAC name is 6-(4-acetylpiperazine-1-carbonyl)-13-cyclohexyl-N-dimethylsulfinamoyloxy-7H-indolo[2,1-a][2]benzazepine-10-carboxamide.
| Compound Name | 6-(4-acetylpiperazine-1-carbonyl)-13-cyclohexyl-N-dimethylsulfinamoyloxy-7H-indolo[2,1-a][2]benzazepine-10-carboxamide |
|---|---|
| PubChem CID | 89371650 |
| Molecular Formula | C33H39N5O5S |
| Molecular Weight | 617.77 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | 6-(4-acetylpiperazine-1-carbonyl)-13-cyclohexyl-N-dimethylsulfinamoyloxy-7H-indolo[2,1-a][2]benzazepine-10-carboxamide |
| SMILES | CC(=O)N1CCN(C(=O)C2=Cc3ccccc3-c3c(C4CCCCC4)c4ccc(C(=O)NOS(=O)N(C)C)cc4n3C2)CC1 |
| InChI | InChI=1S/C33H39N5O5S/c1-22(39)36-15-17-37(18-16-36)33(41)26-19-24-11-7-8-12-27(24)31-30(23-9-5-4-6-10-23)28-14-13-25(20-29(28)38(31)21-26)32(40)34-43-44(42)35(2)3/h7-8,11-14,19-20,23H,4-6,9-10,15-18,21H2,1-3H3,(H,34,40) |
| InChIKey | UEKFBXDLZGBOSN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|