C20H21N3O4 — CID 71213819
N-[4-[2-(2-cyanophenoxy)propanoylamino]-2-hydroxyphenyl]butanamide (PubChem CID 71213819) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[4-[2-(2-cyanophenoxy)propanoylamino]-2-hydroxyphenyl]butanamide.
| Compound Name | N-[4-[2-(2-cyanophenoxy)propanoylamino]-2-hydroxyphenyl]butanamide |
|---|---|
| PubChem CID | 71213819 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[4-[2-(2-cyanophenoxy)propanoylamino]-2-hydroxyphenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(NC(=O)C(C)Oc2ccccc2C#N)cc1O |
| InChI | InChI=1S/C20H21N3O4/c1-3-6-19(25)23-16-10-9-15(11-17(16)24)22-20(26)13(2)27-18-8-5-4-7-14(18)12-21/h4-5,7-11,13,24H,3,6H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | PASZQILSXKMUGJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|