C21H27N5O2 — CID 71215207
5-(3-cyclopentylpropanoylamino)-2-methyl-N-[2-(methylamino)pyrimidin-5-yl]benzamide (PubChem CID 71215207) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-(3-cyclopentylpropanoylamino)-2-methyl-N-[2-(methylamino)pyrimidin-5-yl]benzamide.
| Compound Name | 5-(3-cyclopentylpropanoylamino)-2-methyl-N-[2-(methylamino)pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 71215207 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 5-(3-cyclopentylpropanoylamino)-2-methyl-N-[2-(methylamino)pyrimidin-5-yl]benzamide |
| SMILES | CNc1ncc(NC(=O)c2cc(NC(=O)CCC3CCCC3)ccc2C)cn1 |
| InChI | InChI=1S/C21H27N5O2/c1-14-7-9-16(25-19(27)10-8-15-5-3-4-6-15)11-18(14)20(28)26-17-12-23-21(22-2)24-13-17/h7,9,11-13,15H,3-6,8,10H2,1-2H3,(H,25,27)(H,26,28)(H,22,23,24) |
| InChIKey | VSQZRKUEHXLDLX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |