C25H28N4O2 — CID 22057992
N-[5-(3-cyclohexylpropanoylamino)-2-methylphenyl]quinoxaline-6-carboxamide (PubChem CID 22057992) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[5-(3-cyclohexylpropanoylamino)-2-methylphenyl]quinoxaline-6-carboxamide.
| Compound Name | N-[5-(3-cyclohexylpropanoylamino)-2-methylphenyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 22057992 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[5-(3-cyclohexylpropanoylamino)-2-methylphenyl]quinoxaline-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)CCC2CCCCC2)cc1NC(=O)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C25H28N4O2/c1-17-7-10-20(28-24(30)12-8-18-5-3-2-4-6-18)16-22(17)29-25(31)19-9-11-21-23(15-19)27-14-13-26-21/h7,9-11,13-16,18H,2-6,8,12H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | WDJKIEYAKBVLHL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |