C18H21ClN5O2P — CID 71216122
N-[4-(6-butyl-7-chloro-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenyl]-2-methyl-3-phosphorosopropanamide (PubChem CID 71216122) has the molecular formula C18H21ClN5O2P and a molecular weight of 405.83 g/mol. Its IUPAC name is N-[4-(6-butyl-7-chloro-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenyl]-2-methyl-3-phosphorosopropanamide.
| Compound Name | N-[4-(6-butyl-7-chloro-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenyl]-2-methyl-3-phosphorosopropanamide |
|---|---|
| PubChem CID | 71216122 |
| Molecular Formula | C18H21ClN5O2P |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[4-(6-butyl-7-chloro-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)phenyl]-2-methyl-3-phosphorosopropanamide |
| SMILES | CCCCc1[nH]n2nc(-c3ccc(NC(=O)C(C)CP=O)cc3)nc2c1Cl |
| InChI | InChI=1S/C18H21ClN5O2P/c1-3-4-5-14-15(19)17-21-16(23-24(17)22-14)12-6-8-13(9-7-12)20-18(25)11(2)10-27-26/h6-9,11,22H,3-5,10H2,1-2H3,(H,20,25) |
| InChIKey | VSZVGHPBJDHKIJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|