C20H24ClF3N8O — CID 71218415
4-(butylamino)-2-chloro-N-[3-[5-[[4-(trifluoromethyl)phenyl]methyl]tetrazol-2-yl]propyl]-1H-imidazole-5-carboxamide (PubChem CID 71218415) has the molecular formula C20H24ClF3N8O and a molecular weight of 484.91 g/mol. Its IUPAC name is 4-(butylamino)-2-chloro-N-[3-[5-[[4-(trifluoromethyl)phenyl]methyl]tetrazol-2-yl]propyl]-1H-imidazole-5-carboxamide.
| Compound Name | 4-(butylamino)-2-chloro-N-[3-[5-[[4-(trifluoromethyl)phenyl]methyl]tetrazol-2-yl]propyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 71218415 |
| Molecular Formula | C20H24ClF3N8O |
| Molecular Weight | 484.91 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 4-(butylamino)-2-chloro-N-[3-[5-[[4-(trifluoromethyl)phenyl]methyl]tetrazol-2-yl]propyl]-1H-imidazole-5-carboxamide |
| SMILES | CCCCNc1nc(Cl)[nH]c1C(=O)NCCCn1nnc(Cc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H24ClF3N8O/c1-2-3-9-25-17-16(27-19(21)28-17)18(33)26-10-4-11-32-30-15(29-31-32)12-13-5-7-14(8-6-13)20(22,23)24/h5-8,25H,2-4,9-12H2,1H3,(H,26,33)(H,27,28) |
| InChIKey | RFSARTNFRQKYRD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.91 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|