About 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine
3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine (PubChem CID 71220612) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine |
| PubChem CID | 71220612 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine |
| SMILES | CCc1[nH]c2c(c1C(C)(C)C)=NCCC=2 |
| InChI | InChI=1S/C13H20N2/c1-5-9-11(13(2,3)4)12-10(15-9)7-6-8-14-12/h7,15H,5-6,8H2,1-4H3 |
| InChIKey | WQFHBGBVCYMXPU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine (CID 71220612) is 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine is CCc1[nH]c2c(c1C(C)(C)C)=NCCC=2.
What is the InChIKey of 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is WQFHBGBVCYMXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-5-9-11(13(2,3)4)12-10(15-9)7-6-8-14-12/h7,15H,5-6,8H2,1-4H3.
What are the key properties of 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine?
3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 204.32 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2-ethyl-5,6-dihydro-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 71220612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).