C33H36F3N5O6 — CID 71224798
[(1R,2S,3R)-3-[[3-[(2-cyclopropyl-1,3-oxazole-4-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]-2-hydroxycyclohexyl] 2,2,2-trifluoroacetate (PubChem CID 71224798) has the molecular formula C33H36F3N5O6 and a molecular weight of 655.67 g/mol. Its IUPAC name is [(1R,2S,3R)-3-[[3-[(2-cyclopropyl-1,3-oxazole-4-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]-2-hydroxycyclohexyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,2S,3R)-3-[[3-[(2-cyclopropyl-1,3-oxazole-4-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]-2-hydroxycyclohexyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 71224798 |
| Molecular Formula | C33H36F3N5O6 |
| Molecular Weight | 655.67 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | [(1R,2S,3R)-3-[[3-[(2-cyclopropyl-1,3-oxazole-4-carbonyl)amino]-4-[4-(2-methylphenyl)piperazin-1-yl]benzoyl]amino]-2-hydroxycyclohexyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccccc1N1CCN(c2ccc(C(=O)N[C@@H]3CCC[C@@H](OC(=O)C(F)(F)F)[C@H]3O)cc2NC(=O)c2coc(C3CC3)n2)CC1 |
| InChI | InChI=1S/C33H36F3N5O6/c1-19-5-2-3-7-25(19)40-13-15-41(16-14-40)26-12-11-21(17-23(26)38-30(44)24-18-46-31(39-24)20-9-10-20)29(43)37-22-6-4-8-27(28(22)42)47-32(45)33(34,35)36/h2-3,5,7,11-12,17-18,20,22,27-28,42H,4,6,8-10,13-16H2,1H3,(H,37,43)(H,38,44)/t22-,27-,28+/m1/s1 |
| InChIKey | GBTTZGJENDOCSE-OFEZKSIWSA-N |
| XLogP | 4.56 |
| TPSA | 137.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |