C14H19F2NO2 — CID 71228097
(4-cyano-3,5-difluorocyclohexyl) cyclohexanecarboxylate (PubChem CID 71228097) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is (4-cyano-3,5-difluorocyclohexyl) cyclohexanecarboxylate.
| Compound Name | (4-cyano-3,5-difluorocyclohexyl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 71228097 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (4-cyano-3,5-difluorocyclohexyl) cyclohexanecarboxylate |
| SMILES | N#CC1C(F)CC(OC(=O)C2CCCCC2)CC1F |
| InChI | InChI=1S/C14H19F2NO2/c15-12-6-10(7-13(16)11(12)8-17)19-14(18)9-4-2-1-3-5-9/h9-13H,1-7H2 |
| InChIKey | HVPOTMLJEQGHQV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |