About (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate
(4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate (PubChem CID 90054944) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate |
| PubChem CID | 90054944 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate |
| SMILES | N#CC1CCC(OC(=O)C2CCC(O)CC2)CC1 |
| InChI | InChI=1S/C14H21NO3/c15-9-10-1-7-13(8-2-10)18-14(17)11-3-5-12(16)6-4-11/h10-13,16H,1-8H2 |
| InChIKey | FNXWAKQOPIGQHR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate?
The IUPAC name of (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate (CID 90054944) is (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate.
What is the SMILES notation for (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate?
The canonical SMILES for (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate is N#CC1CCC(OC(=O)C2CCC(O)CC2)CC1.
What is the InChIKey of (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate?
The InChIKey is FNXWAKQOPIGQHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c15-9-10-1-7-13(8-2-10)18-14(17)11-3-5-12(16)6-4-11/h10-13,16H,1-8H2.
What are the key properties of (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate?
(4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate has a molecular weight of 251.33 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanocyclohexyl) 4-hydroxycyclohexane-1-carboxylate is sourced from PubChem (CID 90054944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).