About benzene;4-hydroxycyclohexane-1-carbonitrile
benzene;4-hydroxycyclohexane-1-carbonitrile (PubChem CID 143916958) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is benzene;4-hydroxycyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | benzene;4-hydroxycyclohexane-1-carbonitrile |
| PubChem CID | 143916958 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | benzene;4-hydroxycyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(O)CC1.c1ccccc1 |
| InChI | InChI=1S/C7H11NO.C6H6/c8-5-6-1-3-7(9)4-2-6;1-2-4-6-5-3-1/h6-7,9H,1-4H2;1-6H |
| InChIKey | GMZIPLXVRGWVEA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;4-hydroxycyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4-hydroxycyclohexane-1-carbonitrile?
The IUPAC name of benzene;4-hydroxycyclohexane-1-carbonitrile (CID 143916958) is benzene;4-hydroxycyclohexane-1-carbonitrile.
What is the SMILES notation for benzene;4-hydroxycyclohexane-1-carbonitrile?
The canonical SMILES for benzene;4-hydroxycyclohexane-1-carbonitrile is N#CC1CCC(O)CC1.c1ccccc1.
What is the InChIKey of benzene;4-hydroxycyclohexane-1-carbonitrile?
The InChIKey is GMZIPLXVRGWVEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO.C6H6/c8-5-6-1-3-7(9)4-2-6;1-2-4-6-5-3-1/h6-7,9H,1-4H2;1-6H.
What are the key properties of benzene;4-hydroxycyclohexane-1-carbonitrile?
benzene;4-hydroxycyclohexane-1-carbonitrile has a molecular weight of 203.29 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4-hydroxycyclohexane-1-carbonitrile is sourced from PubChem (CID 143916958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).