C24H29F2N3O2 — CID 71228334
4-[(2,4-difluorophenyl)methyl]-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]piperazin-2-one (PubChem CID 71228334) has the molecular formula C24H29F2N3O2 and a molecular weight of 429.51 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methyl]-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]piperazin-2-one.
| Compound Name | 4-[(2,4-difluorophenyl)methyl]-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]piperazin-2-one |
|---|---|
| PubChem CID | 71228334 |
| Molecular Formula | C24H29F2N3O2 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methyl]-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]piperazin-2-one |
| SMILES | O=C1CN(Cc2ccc(F)cc2F)CCN1c1ccc(OCCCN2CCCC2)cc1 |
| InChI | InChI=1S/C24H29F2N3O2/c25-20-5-4-19(23(26)16-20)17-28-13-14-29(24(30)18-28)21-6-8-22(9-7-21)31-15-3-12-27-10-1-2-11-27/h4-9,16H,1-3,10-15,17-18H2 |
| InChIKey | LJIZWEQAVCWTAB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|