C28H30ClFN2O3 — CID 71228561
2-[2-(2-chloro-5-fluorophenyl)-2-methylpropyl]-2-methyl-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)oct-3-ynamide (PubChem CID 71228561) has the molecular formula C28H30ClFN2O3 and a molecular weight of 497.01 g/mol. Its IUPAC name is 2-[2-(2-chloro-5-fluorophenyl)-2-methylpropyl]-2-methyl-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)oct-3-ynamide.
| Compound Name | 2-[2-(2-chloro-5-fluorophenyl)-2-methylpropyl]-2-methyl-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)oct-3-ynamide |
|---|---|
| PubChem CID | 71228561 |
| Molecular Formula | C28H30ClFN2O3 |
| Molecular Weight | 497.01 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2-[2-(2-chloro-5-fluorophenyl)-2-methylpropyl]-2-methyl-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)oct-3-ynamide |
| SMILES | CCCCC#CC(C)(CC(C)(C)c1cc(F)ccc1Cl)C(=O)Nc1ccc2c(=O)onc(C)c2c1 |
| InChI | InChI=1S/C28H30ClFN2O3/c1-6-7-8-9-14-28(5,17-27(3,4)23-15-19(30)10-13-24(23)29)26(34)31-20-11-12-21-22(16-20)18(2)32-35-25(21)33/h10-13,15-16H,6-8,17H2,1-5H3,(H,31,34) |
| InChIKey | IXGSXQMUSZBQQR-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.01 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|