C14H17FNO4P — CID 71228944
(4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phosphanyl-1,3-oxazolidin-2-one (PubChem CID 71228944) has the molecular formula C14H17FNO4P and a molecular weight of 313.26 g/mol. Its IUPAC name is (4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phosphanyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phosphanyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71228944 |
| Molecular Formula | C14H17FNO4P |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phosphanyl-1,3-oxazolidin-2-one |
| SMILES | O=C(CCC[C@H](O)c1ccc(F)cc1)N1C(=O)OC[C@@H]1P |
| InChI | InChI=1S/C14H17FNO4P/c15-10-6-4-9(5-7-10)11(17)2-1-3-12(18)16-13(21)8-20-14(16)19/h4-7,11,13,17H,1-3,8,21H2/t11-,13-/m0/s1 |
| InChIKey | GVNMPIBRSXIYGV-AAEUAGOBSA-N |
| XLogP | 2.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|