C18H31NO — CID 71229216
4-[3-(3-aminopropyl)phenyl]-2,6-dimethylheptan-4-ol (PubChem CID 71229216) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 4-[3-(3-aminopropyl)phenyl]-2,6-dimethylheptan-4-ol.
| Compound Name | 4-[3-(3-aminopropyl)phenyl]-2,6-dimethylheptan-4-ol |
|---|---|
| PubChem CID | 71229216 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 4-[3-(3-aminopropyl)phenyl]-2,6-dimethylheptan-4-ol |
| SMILES | CC(C)CC(O)(CC(C)C)c1cccc(CCCN)c1 |
| InChI | InChI=1S/C18H31NO/c1-14(2)12-18(20,13-15(3)4)17-9-5-7-16(11-17)8-6-10-19/h5,7,9,11,14-15,20H,6,8,10,12-13,19H2,1-4H3 |
| InChIKey | JKLNSUQUUVNTLM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |