C23H22Cl2N2O3 — CID 71231296
2-[benzyl-[(2R)-2-(2-chloro-4-hydroxyanilino)-2-(4-chlorophenyl)ethyl]amino]acetic acid (PubChem CID 71231296) has the molecular formula C23H22Cl2N2O3 and a molecular weight of 445.35 g/mol. Its IUPAC name is 2-[benzyl-[(2R)-2-(2-chloro-4-hydroxyanilino)-2-(4-chlorophenyl)ethyl]amino]acetic acid.
| Compound Name | 2-[benzyl-[(2R)-2-(2-chloro-4-hydroxyanilino)-2-(4-chlorophenyl)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 71231296 |
| Molecular Formula | C23H22Cl2N2O3 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-[benzyl-[(2R)-2-(2-chloro-4-hydroxyanilino)-2-(4-chlorophenyl)ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccccc1)C[C@H](Nc1ccc(O)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O3/c24-18-8-6-17(7-9-18)22(26-21-11-10-19(28)12-20(21)25)14-27(15-23(29)30)13-16-4-2-1-3-5-16/h1-12,22,26,28H,13-15H2,(H,29,30)/t22-/m0/s1 |
| InChIKey | BUEJUJWYWVHVDI-QFIPXVFZSA-N |
| XLogP | 5.44 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|