C22H20ClN7O — CID 71233785
[7-chloro-5-[(4-pyridin-2-ylpyrimidin-2-yl)amino]-1H-indol-2-yl]-(diazinan-1-yl)methanone (PubChem CID 71233785) has the molecular formula C22H20ClN7O and a molecular weight of 433.90 g/mol. Its IUPAC name is [7-chloro-5-[(4-pyridin-2-ylpyrimidin-2-yl)amino]-1H-indol-2-yl]-(diazinan-1-yl)methanone.
| Compound Name | [7-chloro-5-[(4-pyridin-2-ylpyrimidin-2-yl)amino]-1H-indol-2-yl]-(diazinan-1-yl)methanone |
|---|---|
| PubChem CID | 71233785 |
| Molecular Formula | C22H20ClN7O |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [7-chloro-5-[(4-pyridin-2-ylpyrimidin-2-yl)amino]-1H-indol-2-yl]-(diazinan-1-yl)methanone |
| SMILES | O=C(c1cc2cc(Nc3nccc(-c4ccccn4)n3)cc(Cl)c2[nH]1)N1CCCCN1 |
| InChI | InChI=1S/C22H20ClN7O/c23-16-13-15(27-22-25-9-6-18(29-22)17-5-1-2-7-24-17)11-14-12-19(28-20(14)16)21(31)30-10-4-3-8-26-30/h1-2,5-7,9,11-13,26,28H,3-4,8,10H2,(H,25,27,29) |
| InChIKey | IYRHRWGREFCLIT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |