C26H30F3N5O4 — CID 71235633
1-[(1R,2R)-2-[[(1R,4R,6S)-2-(4-nitrophenyl)-2-azabicyclo[2.2.1]heptan-6-yl]amino]cyclohexyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 71235633) has the molecular formula C26H30F3N5O4 and a molecular weight of 533.55 g/mol. Its IUPAC name is 1-[(1R,2R)-2-[[(1R,4R,6S)-2-(4-nitrophenyl)-2-azabicyclo[2.2.1]heptan-6-yl]amino]cyclohexyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(1R,2R)-2-[[(1R,4R,6S)-2-(4-nitrophenyl)-2-azabicyclo[2.2.1]heptan-6-yl]amino]cyclohexyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 71235633 |
| Molecular Formula | C26H30F3N5O4 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 1-[(1R,2R)-2-[[(1R,4R,6S)-2-(4-nitrophenyl)-2-azabicyclo[2.2.1]heptan-6-yl]amino]cyclohexyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)N[C@@H]1CCCC[C@H]1N[C@H]1C[C@@H]2C[C@H]1N(c1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C26H30F3N5O4/c27-26(28,29)38-20-11-5-17(6-12-20)30-25(35)32-22-4-2-1-3-21(22)31-23-13-16-14-24(23)33(15-16)18-7-9-19(10-8-18)34(36)37/h5-12,16,21-24,31H,1-4,13-15H2,(H2,30,32,35)/t16-,21-,22-,23+,24-/m1/s1 |
| InChIKey | CMHIZBKZNGGNIO-GBMOIUHSSA-N |
| XLogP | 5.18 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|