C23H30N4O4Si — CID 71236311
2-[3-(propan-2-ylcarbamoyl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 71236311) has the molecular formula C23H30N4O4Si and a molecular weight of 454.60 g/mol. Its IUPAC name is 2-[3-(propan-2-ylcarbamoyl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-[3-(propan-2-ylcarbamoyl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 71236311 |
| Molecular Formula | C23H30N4O4Si |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[3-(propan-2-ylcarbamoyl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | CC(C)NC(=O)c1cccc(-c2cnc3c(n2)c(C(=O)O)cn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C23H30N4O4Si/c1-15(2)25-22(28)17-8-6-7-16(11-17)19-12-24-21-20(26-19)18(23(29)30)13-27(21)14-31-9-10-32(3,4)5/h6-8,11-13,15H,9-10,14H2,1-5H3,(H,25,28)(H,29,30) |
| InChIKey | JITVXBJGUJKXDE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|