C15H11Cl2FN2O2 — CID 71239380
2-(2,3-dichloro-6-fluorophenyl)-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide (PubChem CID 71239380) has the molecular formula C15H11Cl2FN2O2 and a molecular weight of 341.17 g/mol. Its IUPAC name is 2-(2,3-dichloro-6-fluorophenyl)-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide.
| Compound Name | 2-(2,3-dichloro-6-fluorophenyl)-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 71239380 |
| Molecular Formula | C15H11Cl2FN2O2 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 2-(2,3-dichloro-6-fluorophenyl)-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide |
| SMILES | O=C(Cc1c(F)ccc(Cl)c1Cl)NC1COc2ncccc21 |
| InChI | InChI=1S/C15H11Cl2FN2O2/c16-10-3-4-11(18)9(14(10)17)6-13(21)20-12-7-22-15-8(12)2-1-5-19-15/h1-5,12H,6-7H2,(H,20,21) |
| InChIKey | QDAVQAJCZHSJPF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|