C17H27N5O3 — CID 71242125
tert-butyl N-[[1-(5-carbamoyl-2-methylpyrimidin-4-yl)piperidin-4-yl]methyl]carbamate (PubChem CID 71242125) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is tert-butyl N-[[1-(5-carbamoyl-2-methylpyrimidin-4-yl)piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(5-carbamoyl-2-methylpyrimidin-4-yl)piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71242125 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | tert-butyl N-[[1-(5-carbamoyl-2-methylpyrimidin-4-yl)piperidin-4-yl]methyl]carbamate |
| SMILES | Cc1ncc(C(N)=O)c(N2CCC(CNC(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C17H27N5O3/c1-11-19-10-13(14(18)23)15(21-11)22-7-5-12(6-8-22)9-20-16(24)25-17(2,3)4/h10,12H,5-9H2,1-4H3,(H2,18,23)(H,20,24) |
| InChIKey | UQXLJUJATLGMIO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |