C22H28O — CID 71242539
1-[2-(cyclohexylmethoxy)propyl]-4-phenylbenzene (PubChem CID 71242539) has the molecular formula C22H28O and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-[2-(cyclohexylmethoxy)propyl]-4-phenylbenzene.
| Compound Name | 1-[2-(cyclohexylmethoxy)propyl]-4-phenylbenzene |
|---|---|
| PubChem CID | 71242539 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-[2-(cyclohexylmethoxy)propyl]-4-phenylbenzene |
| SMILES | CC(Cc1ccc(-c2ccccc2)cc1)OCC1CCCCC1 |
| InChI | InChI=1S/C22H28O/c1-18(23-17-20-8-4-2-5-9-20)16-19-12-14-22(15-13-19)21-10-6-3-7-11-21/h3,6-7,10-15,18,20H,2,4-5,8-9,16-17H2,1H3 |
| InChIKey | JGBPDQDKDAHAOZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |