C31H50F2N2O6 — CID 71244543
(Z)-2-fluoro-N-[(1R,2S)-2-[[(Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoyl]amino]cyclopentyl]-8-(oxan-2-yloxy)oct-2-enamide (PubChem CID 71244543) has the molecular formula C31H50F2N2O6 and a molecular weight of 584.75 g/mol. Its IUPAC name is (Z)-2-fluoro-N-[(1R,2S)-2-[[(Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoyl]amino]cyclopentyl]-8-(oxan-2-yloxy)oct-2-enamide.
| Compound Name | (Z)-2-fluoro-N-[(1R,2S)-2-[[(Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoyl]amino]cyclopentyl]-8-(oxan-2-yloxy)oct-2-enamide |
|---|---|
| PubChem CID | 71244543 |
| Molecular Formula | C31H50F2N2O6 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | (Z)-2-fluoro-N-[(1R,2S)-2-[[(Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoyl]amino]cyclopentyl]-8-(oxan-2-yloxy)oct-2-enamide |
| SMILES | O=C(N[C@H]1CCC[C@H]1NC(=O)/C(F)=C/CCCCCOC1CCCCO1)/C(F)=C/CCCCCOC1CCCCO1 |
| InChI | InChI=1S/C31H50F2N2O6/c32-24(14-5-1-3-9-20-38-28-18-7-11-22-40-28)30(36)34-26-16-13-17-27(26)35-31(37)25(33)15-6-2-4-10-21-39-29-19-8-12-23-41-29/h14-15,26-29H,1-13,16-23H2,(H,34,36)(H,35,37)/b24-14-,25-15-/t26-,27+,28?,29? |
| InChIKey | ITUVOWRZXQVZJQ-GPYPVXMLSA-N |
| XLogP | 6.05 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|