C14H17FN6O — CID 71245036
3-[[5-fluoro-4-[[(3R)-piperidin-3-yl]amino]pyrimidin-2-yl]amino]-1H-pyridin-2-one (PubChem CID 71245036) has the molecular formula C14H17FN6O and a molecular weight of 304.33 g/mol. Its IUPAC name is 3-[[5-fluoro-4-[[(3R)-piperidin-3-yl]amino]pyrimidin-2-yl]amino]-1H-pyridin-2-one.
| Compound Name | 3-[[5-fluoro-4-[[(3R)-piperidin-3-yl]amino]pyrimidin-2-yl]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 71245036 |
| Molecular Formula | C14H17FN6O |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-[[5-fluoro-4-[[(3R)-piperidin-3-yl]amino]pyrimidin-2-yl]amino]-1H-pyridin-2-one |
| SMILES | O=c1[nH]cccc1Nc1ncc(F)c(N[C@@H]2CCCNC2)n1 |
| InChI | InChI=1S/C14H17FN6O/c15-10-8-18-14(20-11-4-2-6-17-13(11)22)21-12(10)19-9-3-1-5-16-7-9/h2,4,6,8-9,16H,1,3,5,7H2,(H,17,22)(H2,18,19,20,21)/t9-/m1/s1 |
| InChIKey | FPPXJPWLMKIXFC-SECBINFHSA-N |
| XLogP | 1.21 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |