C47H30N4 — CID 71246095
7-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9H-fluoren-9-yl]-5,7-dihydroindeno[2,1-b]carbazole (PubChem CID 71246095) has the molecular formula C47H30N4 and a molecular weight of 650.79 g/mol. Its IUPAC name is 7-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9H-fluoren-9-yl]-5,7-dihydroindeno[2,1-b]carbazole.
| Compound Name | 7-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9H-fluoren-9-yl]-5,7-dihydroindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 71246095 |
| Molecular Formula | C47H30N4 |
| Molecular Weight | 650.79 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 7-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9H-fluoren-9-yl]-5,7-dihydroindeno[2,1-b]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C(C3c5ccccc5-c5cc6c(cc53)[nH]c3ccccc36)c3ccccc3-4)n2)cc1 |
| InChI | InChI=1S/C47H30N4/c1-3-13-28(14-4-1)45-49-46(29-15-5-2-6-16-29)51-47(50-45)30-23-24-33-31-17-7-9-20-35(31)43(39(33)25-30)44-36-21-10-8-18-32(36)37-26-38-34-19-11-12-22-41(34)48-42(38)27-40(37)44/h1-27,43-44,48H |
| InChIKey | WSCHGENBDXRNJK-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.79 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |