C12H16FNO5S — CID 71246381
2-[(2-fluoro-6-methoxyphenyl)sulfonyl-methylamino]-2-methylpropanoic acid (PubChem CID 71246381) has the molecular formula C12H16FNO5S and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[(2-fluoro-6-methoxyphenyl)sulfonyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(2-fluoro-6-methoxyphenyl)sulfonyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 71246381 |
| Molecular Formula | C12H16FNO5S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-[(2-fluoro-6-methoxyphenyl)sulfonyl-methylamino]-2-methylpropanoic acid |
| SMILES | COc1cccc(F)c1S(=O)(=O)N(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H16FNO5S/c1-12(2,11(15)16)14(3)20(17,18)10-8(13)6-5-7-9(10)19-4/h5-7H,1-4H3,(H,15,16) |
| InChIKey | LRXFWDNLXJBFSW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |