C23H35NO2 — CID 71246953
(3R,5S,10S,13S)-3,10,13-trimethyl-17-(1,2-oxazol-3-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 71246953) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (3R,5S,10S,13S)-3,10,13-trimethyl-17-(1,2-oxazol-3-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,10S,13S)-3,10,13-trimethyl-17-(1,2-oxazol-3-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 71246953 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (3R,5S,10S,13S)-3,10,13-trimethyl-17-(1,2-oxazol-3-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@]1(O)CC[C@]2(C)C3CC[C@]4(C)C(c5ccon5)CCC4C3CC[C@H]2C1 |
| InChI | InChI=1S/C23H35NO2/c1-21(25)11-12-22(2)15(14-21)4-5-16-17-6-7-19(20-9-13-26-24-20)23(17,3)10-8-18(16)22/h9,13,15-19,25H,4-8,10-12,14H2,1-3H3/t15-,16?,17?,18?,19?,21+,22-,23-/m0/s1 |
| InChIKey | JZECESCKGJGLOO-FWAMOXCMSA-N |
| XLogP | 5.55 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |