C26H43NO2Si — CID 86719951
(3R,5S,8R,9S,10S,13S,14S,17S)-3,10,13-trimethyl-17-(5-trimethylsilyl-1,2-oxazol-3-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 86719951) has the molecular formula C26H43NO2Si and a molecular weight of 429.72 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13S,14S,17S)-3,10,13-trimethyl-17-(5-trimethylsilyl-1,2-oxazol-3-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,8R,9S,10S,13S,14S,17S)-3,10,13-trimethyl-17-(5-trimethylsilyl-1,2-oxazol-3-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 86719951 |
| Molecular Formula | C26H43NO2Si |
| Molecular Weight | 429.72 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | (3R,5S,8R,9S,10S,13S,14S,17S)-3,10,13-trimethyl-17-(5-trimethylsilyl-1,2-oxazol-3-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](c4cc([Si](C)(C)C)on4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H43NO2Si/c1-24(28)13-14-25(2)17(16-24)7-8-18-19-9-10-21(26(19,3)12-11-20(18)25)22-15-23(29-27-22)30(4,5)6/h15,17-21,28H,7-14,16H2,1-6H3/t17-,18-,19-,20-,21+,24+,25-,26-/m0/s1 |
| InChIKey | RDTKKSHMJZRWTB-CPLYLXHJSA-N |
| XLogP | 6.10 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|